CAS 202982-63-6
:Benzenemethanamine, 4-chloro-2-fluoro-, hydrochloride (1:1)
Description:
Benzenemethanamine, 4-chloro-2-fluoro-, hydrochloride (1:1), commonly referred to as a substituted phenethylamine, is a chemical compound characterized by its amine functional group attached to a benzene ring. The presence of chlorine and fluorine substituents on the aromatic ring influences its chemical reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and research. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a ligand in coordination chemistry. Its specific interactions and effects can vary based on the context of use, including potential pharmacological activities. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, the unique combination of functional groups and structural features contributes to its distinct chemical behavior and potential applications in various fields.
Formula:C7H7ClFN·ClH
InChI:InChI=1S/C7H7ClFN.ClH/c8-6-2-1-5(4-10)7(9)3-6;/h1-3H,4,10H2;1H
InChI key:InChIKey=DFRJZBWKVAXYRV-UHFFFAOYSA-N
SMILES:C(N)C1=C(F)C=C(Cl)C=C1.Cl
Synonyms:- (4-Chloro-2-fluorobenzyl)amine hydrochloride
- (4-Chloro-2-fluorophenyl)methanamine hydrochloride
- 1-(4-Chloro-2-Fluorophenyl)Methanamine
- 1-(4-Chloro-2-Fluorophenyl)Methanamine Hydrochloride
- 1-(4-Chloro-2-fluorophenyl)methanamine hydrochloride (1:1)
- Benzenemethanamine, 4-Chloro-2-Fluoro-, Hydrochloride (1:1)
- Benzenemethanamine, 4-chloro-2-fluoro-, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-2-fluorobenzylamine hydrochloride, 97%
CAS:4-Chloro-2-fluorobenzylamine hydrochloride It is used as a primary and secondary intermediate. It is also used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer
Formula:C7H8ClFNPurity:97%Color and Shape:White to cream, Powder and/or lumpsMolecular weight:160.604-Chloro-2-fluorobenzylamine, HCl
CAS:Formula:C7H8Cl2FNPurity:97%Color and Shape:SolidMolecular weight:196.04954-Chloro-2-fluorobenzylamine hydrochloride
CAS:4-Chloro-2-fluorobenzylamine hydrochlorideFormula:C7H7ClFN·ClHPurity:97%Color and Shape: faint brown to dark brown solidMolecular weight:196.05g/mol4-Chloro-2-fluorobenzylamine hydrochloride
CAS:Formula:C7H8Cl2FNPurity:97%Color and Shape:SolidMolecular weight:196.05



