CAS 202982-67-0

1-Chloro-2-fluoro-4-iodobenzene

Description:

1-Chloro-2-fluoro-4-iodobenzene is an aromatic halogenated compound characterized by the presence of three different halogen substituents on a benzene ring. Specifically, it features a chlorine atom at the first position, a fluorine atom at the second position, and an iodine atom at the fourth position of the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its relatively high reactivity due to the presence of multiple halogens, which can influence its chemical behavior in reactions such as nucleophilic substitutions or coupling reactions. The presence of these halogens also affects its physical properties, such as boiling and melting points, as well as its solubility in various solvents. Additionally, 1-chloro-2-fluoro-4-iodobenzene may have applications in organic synthesis, pharmaceuticals, and materials science, particularly in the development of new compounds or as an intermediate in chemical reactions. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.

Formula: C₆H₃ClFI

InChI: InChI=1S/C6H3ClFI/c7-5-2-1-4(9)3-6(5)8/h1-3H

InChI key: InChIKey=VNMRRTIDEYNZOV-UHFFFAOYSA-N

SMILES: FC1=C(Cl)C=CC(I)=C1

Synonyms:

• 1-Chloro-2-fluoro-4-iodobenzene
• 2-Fluoro-4-iodochlorobenzene
• 3-Fluoro-4-chloro iodo benzene
• Benzene, 1-chloro-2-fluoro-4-iodo-
• 4-Chloro-3-fluoroiodobenzene

Benzene, 1-chloro-2-fluoro-4-iodo-

CAS: 202982-67-0

Formula: C₆H₃ClFI

Purity: 98%

Color and Shape: Liquid

Molecular weight: 256.4439

Ref: IN-DA0028LQ

4-Chloro-3-fluoroiodobenzene

CAS: 202982-67-0

4-Chloro-3-fluoroiodobenzene

Formula: C₆H₃ClFI

Purity: 98%

Color and Shape: clear. faint beige liquid

Molecular weight: 256.44g/mol

Ref: 54-PC9033

4-Chloro-3-fluoroiodobenzene

CAS: 202982-67-0

Formula: C₆H₃ClFI

Purity: 98%

Color and Shape: Liquid

Molecular weight: 256.44

Ref: 10-F018374