CAS 20299-79-0

1-(3-Methylphenyl)-1H-pyrrole-2,5-dione

Description:

1-(3-Methylphenyl)-1H-pyrrole-2,5-dione, also known by its CAS number 20299-79-0, is an organic compound characterized by its pyrrole structure, which features a five-membered aromatic ring containing nitrogen. This compound exhibits a diketone functionality due to the presence of two carbonyl groups at the 2 and 5 positions of the pyrrole ring. The presence of a 3-methylphenyl group at the 1-position contributes to its aromatic character and can influence its reactivity and solubility. Typically, compounds of this nature may display interesting biological activities, making them of interest in medicinal chemistry and material science. The molecular structure allows for potential interactions with various biological targets, and its properties can be influenced by substituents on the aromatic ring. Additionally, this compound may exhibit specific physical properties such as melting point, boiling point, and solubility, which are essential for its application in research and industry. Safety data and handling precautions should be considered when working with this substance, as with any chemical compound.

Formula: C₁₁H₉NO₂

InChI: InChI=1/C11H9NO2/c1-8-3-2-4-9(7-8)12-10(13)5-6-11(12)14/h2-7H,1H3

SMILES: Cc1cccc(c1)N1C(=O)C=CC1=O

1H-Pyrrole-2,5-dione, 1-(3-methylphenyl)-

CAS: 20299-79-0

Formula: C₁₁H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.1947

Ref: IN-DA0028MI

1-(3-Methylphenyl)-1H-pyrrole-2,5-dione

CAS: 20299-79-0

1-(3-Methylphenyl)-1H-pyrrole-2,5-dione is an anti-aging compound that has been shown to inhibit the replication of herpes viruses. It also inhibits corrosion, in particular by orthophosphoric acid. The monomer itself is useful as a viscosity agent and can be used in the synthesis of polymers such as dibutyl phthalate. 1-(3-Methylphenyl)-1H-pyrrole-2,5-dione has a high yield and can be used for analyzing magnesium oxide.

Formula: C₁₁H₉NO₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 187.19 g/mol

Ref: 3D-FM137264

1-(3-methylphenyl)-1H-pyrrole-2,5-dione

CAS: 20299-79-0

Formula: C₁₁H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.198

Ref: 10-F371790