
CAS 203-20-3
:Dibenz[a,j]aceanthrylene
Description:
Dibenz[a,j]aceanthrylene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which consists of multiple aromatic rings. It is known for its planar geometry and high stability due to the delocalization of π-electrons across its structure. This compound is typically insoluble in water but soluble in organic solvents, which is a common trait among PAHs. Dibenz[a,j]aceanthrylene exhibits fluorescence properties, making it of interest in various applications, including organic electronics and materials science. Its chemical behavior is influenced by the presence of multiple aromatic rings, which can participate in π-π stacking interactions. Additionally, like many PAHs, it may pose environmental and health concerns due to its potential mutagenic and carcinogenic properties. As a result, its handling and usage are often subject to regulatory scrutiny. Overall, dibenz[a,j]aceanthrylene serves as a significant compound in the study of organic chemistry and materials science, particularly in the context of its electronic properties and environmental impact.
Formula:C24H14
InChI:InChI=1S/C24H14/c1-2-8-17-15(6-1)12-13-21-22(17)14-16-7-5-11-19-18-9-3-4-10-20(18)24(21)23(16)19/h1-14H
InChI key:InChIKey=ZUAGUFSITPHNKC-UHFFFAOYSA-N
SMILES:C1=2C=3C(C=4C1=CC=CC4)=CC=CC3C=C5C2C=CC=6C5=CC=CC6
Synonyms:- 15,16-Benzodehydrocholanthrene
- Naphtho[2,1-a]fluoranthene
- Dibenz[a,j]aceanthrylene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
