
CAS 2030-55-9
:(1S,2R,3aR,12bS,12cR)-2,3,3a,4,5,7,12b,12c-Octahydro-1H-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridine-1,2-diol
Description:
The chemical substance with the name "(1S,2R,3aR,12bS,12cR)-2,3,3a,4,5,7,12b,12c-Octahydro-1H-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridine-1,2-diol" and CAS number 2030-55-9 is a complex organic compound characterized by its unique bicyclic structure that incorporates both dioxole and pyrrolo moieties. This compound features multiple stereocenters, which contribute to its chiral nature and may influence its biological activity and interactions. The presence of hydroxyl groups indicates potential for hydrogen bonding, which can affect solubility and reactivity. Its octahydro framework suggests a saturated structure, likely contributing to stability and potentially influencing its pharmacokinetic properties. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, particularly in the development of pharmaceuticals. The specific stereochemistry and functional groups present in this compound may also play a critical role in its mechanism of action and efficacy in biological systems.
Formula:C16H19NO4
InChI:InChI=1S/C16H19NO4/c18-11-3-8-1-2-17-6-9-4-12-13(21-7-20-12)5-10(9)14(15(8)17)16(11)19/h4-5,8,11,14-16,18-19H,1-3,6-7H2/t8-,11-,14+,15-,16-/m1/s1
InChI key:InChIKey=VJILFEGOWCJNIK-YDJYNKLNSA-N
SMILES:O[C@H]1[C@@]2([C@@]3(N(CC=4C2=CC5=C(C4)OCO5)CC[C@@]3(C[C@H]1O)[H])[H])[H]
Synonyms:- Galanthan-1,2-diol, 9,10-[methylenebis(oxy)]-, (1α,2α)-
- Lycoran-1α,2α-diol
- Zephyranthine
- 1H-[1,3]Dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridine-1,2-diol, 2,3,3a,4,5,7,12b,12c-octahydro-, (1S,2R,3aR,12bS,12cR)-
- (1S,2R,3aR,12bS,12cR)-2,3,3a,4,5,7,12b,12c-Octahydro-1H-[1,3]dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridine-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1H-[1,3]Dioxolo[4,5-j]pyrrolo[3,2,1-de]phenanthridine-1,2-diol, 2,3,3a,4,5,7,12b,12c-octahydro-, (1S,2R,3aR,12bS,12cR)-
CAS:Formula:C16H19NO4Molecular weight:289.3264Zephyranthine
CAS:Zephyranthine is a biochemical.Formula:C16H19NO4Color and Shape:SolidMolecular weight:289.331

