CAS 203047-35-2

1,1-Dimethylethyl 4-[(3-cyanophenyl)methyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[(3-cyanophenyl)methyl]-1-piperazinecarboxylate, identified by its CAS number 203047-35-2, is a chemical compound characterized by its complex structure, which includes a piperazine ring, a carboxylate group, and a cyanophenyl moiety. This compound typically exhibits properties associated with piperazine derivatives, such as potential pharmacological activity, including anxiolytic or antidepressant effects. The presence of the dimethyl group contributes to its steric hindrance, which may influence its interaction with biological targets. Additionally, the cyanophenyl group may enhance lipophilicity, affecting its solubility and permeability in biological systems. The compound is likely to be a solid at room temperature and may have moderate stability under standard conditions. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many piperazine derivatives, it may be of interest in medicinal chemistry for the development of new therapeutic agents.

Formula: C₁₇H₂₃N₃O₂

InChI: InChI=1S/C17H23N3O2/c1-17(2,3)22-16(21)20-9-7-19(8-10-20)13-15-6-4-5-14(11-15)12-18/h4-6,11H,7-10,13H2,1-3H3

InChI key: InChIKey=LHNLUSMHXRJUKL-UHFFFAOYSA-N

SMILES: C(C1=CC(C#N)=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1-Piperazinecarboxylic acid, 4-[(3-cyanophenyl)methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[(3-cyanophenyl)methyl]-1-piperazinecarboxylate

tert-Butyl 4-(3-cyanobenzyl)piperazine-1-carboxylate

CAS: 203047-35-2

tert-Butyl 4-(3-cyanobenzyl)piperazine-1-carboxylate

Purity: ≥95%

Molecular weight: 301.38g/mol

Ref: 54-OR111185

TERT-BUTYL 4-(3-CYANOBENZYL)PIPERAZINE-1-CARBOXYLATE

CAS: 203047-35-2

Formula: C₁₇H₂₃N₃O₂

Purity: 95.0%

Molecular weight: 301.39

Ref: 10-F390020