CAS 203059-80-7

1,2-Difluoro-4,5-dimethoxybenzene

Description:

1,2-Difluoro-4,5-dimethoxybenzene is an aromatic compound characterized by the presence of two fluorine atoms and two methoxy groups attached to a benzene ring. The fluorine substituents are located at the 1 and 2 positions, while the methoxy groups are positioned at the 4 and 5 positions, contributing to the compound's overall electronic and steric properties. This structure influences its reactivity and solubility, making it a valuable intermediate in organic synthesis and pharmaceuticals. The presence of fluorine atoms typically enhances the compound's lipophilicity and stability, while the methoxy groups can serve as electron-donating groups, affecting the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, 1,2-difluoro-4,5-dimethoxybenzene may exhibit unique physical properties, such as boiling and melting points, which are influenced by its molecular structure and intermolecular interactions. Overall, this compound is of interest in various fields, including medicinal chemistry and materials science, due to its distinctive characteristics and potential applications.

Formula: C₈H₈F₂O₂

InChI: InChI=1S/C8H8F2O2/c1-11-7-3-5(9)6(10)4-8(7)12-2/h3-4H,1-2H3

InChI key: InChIKey=WWAOVLXLTJXDGS-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C=C(F)C(F)=C1

Synonyms:

• Benzene, 1,2-difluoro-4,5-dimethoxy-
• 1,2-Difluoro-4,5-dimethoxybenzene

1,2-Difluoro-4,5-dimethoxybenzene

CAS: 203059-80-7

Formula: C₈H₈F₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.1447

Ref: IN-DA003DEC

1,2-Difluoro-4,5- dimethoxybenzene, min. 96%

CAS: 203059-80-7

Formula: C₈H₈F₂O₂

Purity: min. 96%

Color and Shape: White solid/ Clear, colorless liquid dependent on the temperature

Molecular weight: 174.15

Ref: 08-09-0072

1,2-Difluoro-4,5-dimethoxybenzene

CAS: 203059-80-7

1,2-Difluoro-4,5-dimethoxybenzene

Formula: C₈H₈F₂O₂

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 174.14g/mol

Ref: 54-PC8185

1,2-Difluoro-4,5-dimethoxybenzene

CAS: 203059-80-7

Formula: C₈H₈F₂O₂

Purity: >95.0%(GC)

Color and Shape: White to Light yellow powder to lump

Molecular weight: 174.15

Ref: 3B-D3626

1,2-Difluoro-4,5-dimethoxybenzene

CAS: 203059-80-7

Formula: C₈H₈F₂O₂

Purity: 98%(GC-MS);RG

Color and Shape: Solid

Molecular weight: 174.147

Ref: 10-F013301

1,2-Difluoro-4,5-dimethoxybenzene

CAS: 203059-80-7

Diffraction is a technique that is used to measure the angles of the reflections from a crystal or other material. Single-crystal x-ray diffraction (SCXRD) is one form of diffraction that uses a single crystal to generate an image. Diffraction was first observed in 1807 by English scientist William Hyde Wollaston and French physicist Joseph von Fraunhofer. Diffraction can be used to determine the structures of ionic, linear, or annulated frameworks, such as those found in 1,2-Difluoro-4,5-dimethoxybenzene. The molecular geometry and relative orientation of the atoms in these frameworks can be determined through diffraction. This technique is often used to characterize polymers with cyclic structures such as penicillin and cyclic voltammetry.
Diffraction studies have shown that 1,2-Difluoro-4,5-dimethoxybenzene has a hydroxylase

Formula: C₈H₈F₂O₂

Purity: Min. 97 Area-%

Color and Shape: Powder

Molecular weight: 174.14 g/mol

Ref: 3D-FD67949