CAS 2031-90-5
:pentane-D12
Description:
Pentane-D12, also known as dodeuteriopentane, is a deuterated form of pentane, where all twelve hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen. Its chemical formula is C5D12, and it is primarily used in research and analytical chemistry, particularly in studies involving nuclear magnetic resonance (NMR) spectroscopy. The presence of deuterium alters the physical and chemical properties of the molecule compared to its non-deuterated counterpart, such as changes in boiling and melting points, density, and reactivity. Pentane-D12 is a colorless, odorless liquid at room temperature and is typically used as a solvent in various chemical reactions and analyses. Its unique isotopic composition allows for enhanced resolution in spectroscopic techniques, making it valuable in the study of molecular dynamics and interactions. Additionally, due to its deuterated nature, it is less prone to hydrogen exchange reactions, which can be advantageous in certain experimental conditions.
Formula:C5D12
InChI:InChI=1/C5H12/c1-3-5-4-2/h3-5H2,1-2H3/i1D3,2D3,3D2,4D2,5D2
SMILES:C(C(C(C(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]
Synonyms:- (~2~H_12_)pentane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
n-Pentane-d{12}, 98%(Isotopic)
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5D12Purity:98%Molecular weight:84.22n-Pentane-d12
CAS:Formula:CD3(CD2)3CD3Purity:98 atom % DColor and Shape:Colorless LiquidMolecular weight:84.16922N-Pentane-d12
CAS:Controlled ProductStability Volatile
Applications N-Pentane-D12 (D, 98%) (cas# 2031-90-5) is a useful research chemical.
E3Formula:C5D12Color and Shape:NeatMolecular weight:84.22




