CAS 2031259-29-5

1,2,4-Triazolo[4,3-a]pyrazine-6-carboxylic acid, 5,6,7,8-tetrahydro-3,7-dimethyl-, hydrochloride (1:2)

Description:

1,2,4-Triazolo[4,3-a]pyrazine-6-carboxylic acid, 5,6,7,8-tetrahydro-3,7-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which incorporates both triazole and pyrazine moieties. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties, while the hydrochloride form indicates it is a salt, which can enhance solubility in polar solvents. The tetrahydro and dimethyl substitutions contribute to its steric and electronic characteristics, potentially influencing its reactivity and interaction with other molecules. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could confer specific biological activities. As with many such compounds, its stability, solubility, and reactivity would be influenced by environmental conditions such as pH and temperature.

Formula: C₈H₁₂N₄O₂·2ClH

InChI: InChI=1S/C8H12N4O2.2ClH/c1-5-9-10-7-4-11(2)6(8(13)14)3-12(5)7;;/h6H,3-4H2,1-2H3,(H,13,14);2*1H

InChI key: InChIKey=WBKMUVJKFQORMD-UHFFFAOYSA-N

SMILES: CC=1N2C(CN(C)C(C(O)=O)C2)=NN1.Cl

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyrazine-6-carboxylic acid, 5,6,7,8-tetrahydro-3,7-dimethyl-, hydrochloride (1:2)

3,7-Dimethyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid dihydrochloride

CAS: 2031259-29-5

Versatile small molecule scaffold

Formula: C₈H₁₄Cl₂N₄O₂

Purity: Min. 95%

Molecular weight: 269.13 g/mol

Ref: 3D-GGD25929