CAS 2031260-76-9

2-Naphthalenemethanol, 2-amino-6-bromo-1,2,3,4-tetrahydro-, hydrochloride (1:1)

Description:

2-Naphthalenemethanol, 2-amino-6-bromo-1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and a tetrahydro derivative. The presence of an amino group and a bromo substituent indicates potential reactivity and biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound's molecular structure suggests it may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would require empirical investigation. Its CAS number, 2031260-76-9, allows for precise identification in chemical databases. Safety and handling considerations are essential, as with many brominated compounds, due to potential toxicity. Overall, this compound represents a unique intersection of organic chemistry and pharmacology, warranting further study to elucidate its full range of properties and potential applications.

Formula: C₁₁H₁₄BrNO·ClH

InChI: InChI=1S/C11H14BrNO.ClH/c12-10-2-1-9-6-11(13,7-14)4-3-8(9)5-10;/h1-2,5,14H,3-4,6-7,13H2;1H

InChI key: InChIKey=LOOGLQDLTPNUCZ-UHFFFAOYSA-N

SMILES: C(O)C1(N)CC=2C(CC1)=CC(Br)=CC2.Cl

Synonyms:

• 2-Naphthalenemethanol, 2-amino-6-bromo-1,2,3,4-tetrahydro-, hydrochloride (1:1)

(2-Amino-6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)methanol hydrochloride

CAS: 2031260-76-9

Versatile small molecule scaffold

Formula: C₁₁H₁₅BrClNO

Purity: Min. 95%

Molecular weight: 292.6 g/mol

Ref: 3D-GGD26076