CAS 2031261-19-3

4-Pyridinamine, 2-(methylthio)-, hydrochloride (1:1)

Description:

4-Pyridinamine, 2-(methylthio)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) at the 4-position and a methylthio group (-S-CH3) at the 2-position of the pyridine ring, contributing to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. The presence of the amino group allows for potential interactions such as hydrogen bonding, making it useful in various chemical reactions and applications, including pharmaceuticals and agrochemicals. The methylthio group can influence the compound's electronic properties and steric hindrance, affecting its biological activity. Overall, this compound's structure and functional groups suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₆H₈N₂S·ClH

InChI: InChI=1S/C6H8N2S.ClH/c1-9-6-4-5(7)2-3-8-6;/h2-4H,1H3,(H2,7,8);1H

InChI key: InChIKey=ZODKCPSADKPBOG-UHFFFAOYSA-N

SMILES: S(C)C1=CC(N)=CC=N1.Cl

Synonyms:

• 4-Pyridinamine, 2-(methylthio)-, hydrochloride (1:1)
• 2-Methylsulfanylpyridin-4-amine hydrochloride

2-(Methylsulfanyl)pyridin-4-amine hydrochloride

CAS: 2031261-19-3

Versatile small molecule scaffold

Formula: C₆H₉ClN₂S

Purity: Min. 95%

Molecular weight: 176.67 g/mol

Ref: 3D-GGD26119