
CAS 20315-30-4
:rel-1,2-Dimethyl (1R,2S)-3,3-dimethyl-1,2-cyclopropanedicarboxylate
Description:
Rel-1,2-Dimethyl (1R,2S)-3,3-dimethyl-1,2-cyclopropanedicarboxylate, with CAS number 20315-30-4, is a chemical compound characterized by its unique cyclopropane structure, which features two carboxylate ester functional groups. This compound is typically a colorless to pale yellow liquid, exhibiting a pleasant odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic cyclopropane ring. The stereochemistry indicated by the (1R,2S) configuration suggests specific spatial arrangements of the substituents around the chiral centers, which can influence its reactivity and interactions in chemical reactions. This compound may be utilized in organic synthesis and as an intermediate in the production of various chemical entities. Its stability and reactivity can be affected by factors such as temperature and the presence of catalysts. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C9H14O4
InChI:InChI=1/C9H14O4/c1-9(2)5(7(10)12-3)6(9)8(11)13-4/h5-6H,1-4H3/t5-,6+
InChI key:InChIKey=JVZYMEXLQMHFCI-OLQVQODUNA-N
SMILES:C(OC)(=O)[C@H]1[C@@H](C(OC)=O)C1(C)C
Synonyms:- 1,2-Cyclopropanedicarboxylic acid, 3,3-dimethyl-, dimethyl ester, (1R,2S)-rel-
- rel-1,2-Dimethyl (1R,2S)-3,3-dimethyl-1,2-cyclopropanedicarboxylate
- 1,2-Cyclopropanedicarboxylic acid, 3,3-dimethyl-, dimethyl ester, cis-
- 1,2-Cyclopropanedicarboxylic acid, 3,3-dimethyl-, 1,2-dimethyl ester, (1R,2S)-rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,2-Cyclopropanedicarboxylic acid, 3,3-dimethyl-, 1,2-dimethyl ester, (1R,2S)-rel-
CAS:Formula:C9H14O4Molecular weight:186.2051
