CAS 20319-44-2
:dimethyl 5-methoxybenzene-1,3-dicarboxylate
Description:
Dimethyl 5-methoxybenzene-1,3-dicarboxylate, with the CAS number 20319-44-2, is an organic compound characterized by its structure, which includes two carboxylate groups and a methoxy substituent on a benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the methoxy group enhances its reactivity and can influence its chemical behavior, making it useful in various synthetic applications, particularly in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, its dicarboxylate nature allows for potential applications in esterification reactions and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H12O5
InChI:InChI=1/C11H12O5/c1-14-9-5-7(10(12)15-2)4-8(6-9)11(13)16-3/h4-6H,1-3H3
SMILES:COc1cc(cc(c1)C(=O)OC)C(=O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3-Benzenedicarboxylic acid, 5-methoxy-, 1,3-dimethyl ester
CAS:Formula:C11H12O5Purity:95%Color and Shape:SolidMolecular weight:224.2100Dimethyl 5-Methoxyisophthalate
CAS:Dimethyl 5-MethoxyisophthalatePurity:99%Molecular weight:224.21g/molDimethyl 5-methoxyisophthalate
CAS:Formula:C11H12O5Purity:95%Color and Shape:SolidMolecular weight:224.212Dimethyl 5-methoxyisophthalate
CAS:Dimethyl 5-methoxyisophthalate is a supramolecular compound that has a pyrrole ring. It can be used as a ligand to form macrocycles and can also be used in the formylation of salicylic acid. Dimethyl 5-methoxyisophthalate is synthesized from salicylic acid in the presence of formaldehyde, yielding thermally stable macrocycles with functional groups on their surface. Dimethyl 5-methoxyisophthalate is soluble in organic solvents such as acetonitrile and dichloromethane.
Formula:C11H12O5Purity:Min. 95%Molecular weight:224.21 g/mol



