CAS 2032-34-0
:3,3-Diethoxypropionitrile
Description:
3,3-Diethoxypropionitrile is an organic compound characterized by its structure, which includes a propionitrile backbone with two ethoxy groups attached to the third carbon. This compound is typically a colorless to pale yellow liquid and is known for its moderate volatility and solubility in organic solvents. It has a molecular formula that reflects its functional groups, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitrile group (-C≡N) imparts certain polar characteristics, making it useful in various chemical reactions, including nucleophilic additions and as a building block in the synthesis of more complex molecules. Additionally, 3,3-Diethoxypropionitrile may exhibit properties such as stability under standard conditions, but it should be handled with care due to potential toxicity associated with nitrile compounds. Its applications can range from pharmaceuticals to agrochemicals, depending on the specific reactivity and functionalization of the compound in synthetic pathways.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-3-9-7(5-6-8)10-4-2/h7H,3-5H2,1-2H3
InChI key:InChIKey=WBOXEOCWOCJQNK-UHFFFAOYSA-N
SMILES:C(CC#N)(OCC)OCC
Synonyms:- 1,1-Diethoxy-2-cyanoethane
- 3,3-Diethoxypropanenitrile
- 3,3-Diethoxypropionitrile
- Acetaldehyde, cyano-, diethyl acetal
- Cyanoacetaldehyde diethylacetal
- Malonaldehydenitrile diethyl acetal
- Propanenitrile, 3,3-diethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,3-Diethoxypropionitrile
CAS:Formula:C7H13NO2Purity:>95.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:143.19Propanenitrile, 3,3-diethoxy-
CAS:Formula:C7H13NO2Purity:97%Color and Shape:LiquidMolecular weight:143.18363,3-Diethoxypropanenitrile
CAS:3,3-DiethoxypropanenitrilePurity:97%Color and Shape:Colourless To Orange LiquidMolecular weight:143.18g/mol3,3-Diethoxypropionitrile
CAS:3,3-Diethoxypropionitrile (3,3-DEP) is a synthetic compound that has been shown to have high specificity for terminal alkynes. It is activated by hydrochloric acid and reacts with terminal alkynes in a reaction mechanism that starts with the formation of an acetaldehyde intermediate. The reaction system is catalyzed by an acidic catalyst, such as HCl or HBr. 3,3-DEP can be used in the synthesis of a number of pharmaceuticals, including bosutinib. This drug inhibits the growth of cells that are resistant to other treatments, such as c1-c3.Formula:C7H13NO2Purity:Min. 97%Color and Shape:Clear LiquidMolecular weight:143.18 g/molCyanoacetaldehyde diethylacetal
CAS:Formula:C7H13NO2Purity:95%Color and Shape:LiquidMolecular weight:143.1863,3-Diethoxypropionitrile
CAS:Controlled ProductApplications 3,3-Diethoxypropionitrile is a propionitrile derivative used in the preparation of various biologically active compounds such as p38α mitogen-activated protein kinase inhibitors.
References Goldstein, D.M. et al.: J. Med. Chem., 54, 2255 (2011);Formula:C7H13NO2Color and Shape:NeatMolecular weight:143.18





