
CAS 20320-35-8
:2-(tert-butylcarbamoyl)benzoate
Description:
2-(tert-Butylcarbamoyl)benzoate, identified by its CAS number 20320-35-8, is an organic compound that features a benzoate moiety substituted with a tert-butylcarbamoyl group. This compound typically exhibits characteristics common to esters and amides, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The tert-butyl group contributes to steric hindrance, which can influence the compound's reactivity and interactions with other molecules. The benzoate portion of the molecule suggests potential applications in areas such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound may also exhibit specific physical properties such as melting and boiling points that are influenced by its molecular structure. Additionally, its stability and reactivity can be affected by environmental conditions, making it important to consider when handling or utilizing this substance in various chemical processes. Overall, 2-(tert-butylcarbamoyl)benzoate represents a unique structure with potential applications in diverse chemical fields.
Formula:C12H14NO3
InChI:InChI=1/C12H15NO3/c1-12(2,3)13-10(14)8-6-4-5-7-9(8)11(15)16/h4-7H,1-3H3,(H,13,14)(H,15,16)/p-1
SMILES:CC(C)(C)N=C(c1ccccc1C(=O)O)[O-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-[(tert-Butylamino)carbonyl]benzoic acid
CAS:2-[(tert-Butylamino)carbonyl]benzoic acid is an organic compound that is used as a chemical intermediate. It has a carboxylic acid group, which can be used for esterification or amidation reactions to create different derivatives. 2-[(tert-Butylamino)carbonyl]benzoic acid is deactivated by chlorine and other halogens, and can be reactivated through the addition of glycine or sodium bicarbonate. 2-[(tert-Butylamino)carbonyl]benzoic acid also suppresses malonic acid when mixed with mixtures and solutions of this compound.Formula:C12H15NO3Purity:Min. 95%Molecular weight:221.25 g/molRef: 3D-VAA32035
Discontinued product

