CAS 20327-23-5
:1-Cyclopropylpiperazine
Description:
1-Cyclopropylpiperazine is a chemical compound characterized by its unique bicyclic structure, which includes a piperazine ring and a cyclopropyl group. The piperazine moiety consists of a six-membered ring containing two nitrogen atoms at opposite positions, contributing to its basicity and potential for forming salts. The cyclopropyl group, a three-membered carbon ring, introduces strain and can influence the compound's reactivity and interaction with biological targets. This compound is often studied for its pharmacological properties, particularly in the context of neuropharmacology, as it may exhibit activity at various neurotransmitter receptors. Its molecular formula typically reflects a moderate molecular weight, and it is generally soluble in organic solvents. 1-Cyclopropylpiperazine is of interest in medicinal chemistry for its potential applications in developing therapeutic agents, particularly in treating psychiatric disorders. However, as with many chemical substances, its safety profile and biological effects require thorough investigation to understand its implications for human health and environmental impact.
Formula:C7H14N2
InChI:InChI=1/C7H14N2/c1-2-7(1)9-5-3-8-4-6-9/h7-8H,1-6H2
SMILES:C1CC1N1CCNCC1
Synonyms:- N-cyclopropylpiperazine
- 1-Cycloproylpiperazine
- Cyclopropyl piperazine
- 1-(Cyclopropyl)Piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Cyclopropylpiperazine
CAS:Formula:C7H14N2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:126.20Piperazine, 1-cyclopropyl-
CAS:Formula:C7H14N2Purity:98%Color and Shape:LiquidMolecular weight:126.1995Ref: IN-DA0028S5
1kgTo inquire250mg24.00€1g30.00€5g52.00€10g72.00€25g124.00€50g196.00€100g241.00€250g586.00€1-Cyclopropylpiperazine
CAS:1-CyclopropylpiperazineFormula:C7H14N2Purity:≥95%Color and Shape: colourless to light yellow liquidMolecular weight:126.20g/mol1-Cyclopropylpiperazine
CAS:1-Cyclopropylpiperazine is a nitrogen-containing organic compound that is part of a class of compounds called cyclopropylamines. It has been shown to have neuroprotective effects in animal models of Parkinson's disease and Alzheimer's disease. It also has anti-inflammatory effects and shows promise as an anticancer agent. 1-Cyclopropylpiperazine interacts with phosphatidylinositol-3 kinase (PI3K) and inhibits the formation of fatty acid molecules, which are involved in degenerative diseases and inflammatory diseases, such as cancer.Formula:C7H14N2Purity:Min. 95%Molecular weight:126.2 g/mol




