CAS 20328-15-8
:Ethyl 3-methylisoxazole-4-carboxylate
Description:
Ethyl 3-methylisoxazole-4-carboxylate is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features an ethyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the methyl group at the 3-position of the isoxazole ring influences its chemical properties, including its potential for various chemical reactions and interactions. Ethyl 3-methylisoxazole-4-carboxylate is often utilized in organic synthesis and medicinal chemistry, serving as a building block for the development of pharmaceuticals and agrochemicals. Its molecular structure allows for diverse applications, including acting as a precursor in the synthesis of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and the presence of other reagents. Overall, its unique structural features make it a valuable compound in various chemical research and industrial applications.
Formula:C7H9NO3
InChI:InChI=1/C7H9NO3/c1-3-10-7(9)6-4-11-8-5(6)2/h4H,3H2,1-2H3
SMILES:CCOC(=O)c1conc1C
Synonyms:- 3-Methylisoxazole-4-carboxylic acid ethyl ester
- Ethyl 3-Methyl-1,2-Oxazole-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethyl 3-methylisoxazole-4-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H9NO3Purity:97%Color and Shape:Clear colorless to yellow to orange, LiquidMolecular weight:155.154-Isoxazolecarboxylic acid, 3-methyl-, ethyl ester
CAS:Formula:C7H9NO3Purity:96%Color and Shape:SolidMolecular weight:155.1513Ethyl 3-methylisoxazole-4-carboxylate
CAS:Ethyl 3-methylisoxazole-4-carboxylatePurity:95%Molecular weight:155.15g/molEthyl 3-methylisoxazole-4-carboxylate
CAS:Formula:C7H9NO3Purity:96%Color and Shape:LiquidMolecular weight:155.153





