CAS 20329-98-0: (E)-3,4,5-Trimethoxycinnamic acid
Description:(E)-3,4,5-Trimethoxycinnamic acid is an organic compound characterized by its structure, which features a cinnamic acid backbone with three methoxy groups attached to the aromatic ring. This compound typically exhibits a yellow to orange crystalline appearance and is known for its potential biological activities, including antioxidant and anti-inflammatory properties. The presence of the methoxy groups enhances its lipophilicity, influencing its solubility and reactivity. As a derivative of cinnamic acid, it retains the conjugated double bond system, which can contribute to its UV-absorbing capabilities, making it of interest in cosmetic formulations. The compound's molecular formula reflects its complex structure, and it is often studied for its potential applications in pharmaceuticals and natural product chemistry. Additionally, its synthesis can involve various organic reactions, including esterification and methoxylation processes. Overall, (E)-3,4,5-Trimethoxycinnamic acid is a notable compound in the field of organic chemistry with diverse applications.
Formula:C12H14O5
InChI:InChI=1S/C12H14O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14)/b5-4+
InChI key:InChIKey=YTFVRYKNXDADBI-SNAWJCMRSA-N
SMILES:O=C(O)C=CC1=CC(OC)=C(OC)C(OC)=C1
- Synonyms:
- (2E)-3-(3,4,5-Trimethoxyphenyl)-2-propenoic acid
- (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate
- (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid
- (2Z)-3-(3,4,5-trimethoxyphenyl)prop-2-enoic acid
- (E)-3,4,5-Trimethoxycinnamic acid
- (E)-3,4,5-Trimethoxyphenylacrylic acid
- (E)-3-(3,4,5-Trimethoxyphenyl)acrylic acid
- 2-Propenoic acid, 3-(3,4,5-trimethoxyphenyl)-, (2E)-
- 2-Propenoic acid, 3-(3,4,5-trimethoxyphenyl)-, (E)-
- 3,4,5-Trimethoxy-trans-cinnamic acid
- See more synonyms
- 3,4,5-Trimethoxycinnamic
- 3-(3,4,5-Trimethoxyphenyl)Prop-2-Enoic Acid
- Cinnamic acid, 3,4,5-trimethoxy-, (E)-
- trans-3,4,5-Trimethoxycinnamic acid
