CAS 20336-15-6

2,4,6-tri-tert-butylpyridine

Description:

2,4,6-Tri-tert-butylpyridine is an organic compound characterized by its pyridine ring substituted with three tert-butyl groups at the 2, 4, and 6 positions. This structure imparts significant steric hindrance, making the compound relatively bulky. It is a colorless to pale yellow liquid or solid, depending on temperature, and is known for its high thermal stability and low volatility. The presence of the tert-butyl groups enhances its lipophilicity, making it soluble in organic solvents while being less soluble in water. This compound exhibits basic properties due to the nitrogen atom in the pyridine ring, which can accept protons. 2,4,6-Tri-tert-butylpyridine is often used as a ligand in coordination chemistry and as an additive in various chemical reactions to stabilize intermediates or to enhance reaction rates. Its unique structure and properties make it valuable in synthetic organic chemistry and materials science. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₇H₂₉N

InChI: InChI=1/C17H29N/c1-15(2,3)12-10-13(16(4,5)6)18-14(11-12)17(7,8)9/h10-11H,1-9H3

SMILES: CC(C)(C)c1cc(C(C)(C)C)nc(c1)C(C)(C)C

Synonyms:

• Pyridine, 2,4,6-tris(1,1-dimethylethyl)-

Pyridine, 2,4,6-tris(1,1-dimethylethyl)-

CAS: 20336-15-6

Formula: C₁₇H₂₉N

Purity: 99%

Color and Shape: Solid

Molecular weight: 247.4189

Ref: IN-DA0028US

2,4,6-Tri-Tert-Butylpyridine

CAS: 20336-15-6

2,4,6-Tri-Tert-Butylpyridine

Purity: 99%

Molecular weight: 247.42g/mol

Ref: 54-OR1023606

2,4,6-Tritert-butylpyridine

Controlled Product

CAS: 20336-15-6

Applications 2,4,6-Tritert-butylpyridine is used in the synthesis of acceptors in organic solar cells.
References Morgan, M., et al.: Chem. Comm., 55, 11095-11098 (2019)

Formula: C₁₇H₂₉N

Color and Shape: Neat

Molecular weight: 247.42

Ref: TR-T886910

2,4,6-Tri-tert-butylpyridine

CAS: 20336-15-6

2,4,6-Tri-tert-butylpyridine is a molecule with the chemical formula C9H14N2. It has a molecular weight of 174.24 g/mol and a melting point of -35°C. This compound is synthesized by reacting 2,4,6-trichloropyridine with trifluoromethanesulfonic acid in glycosylations yielding the desired product as an anion radical coupling reaction product. The structure of 2,4,6-tri-tert-butylpyridine is determined by its conformation and cationic polymerization. This compound has been shown to have kinetic isotope effects.

Formula: C₁₇H₂₉N

Purity: Min. 95%

Molecular weight: 247.42 g/mol

Ref: 3D-VAA33615