CymitQuimica logo

CAS 2034-23-3

:

5-chloro-1,3-dihydro-2H-benzimidazol-2-one

Description:
5-Chloro-1,3-dihydro-2H-benzimidazol-2-one is a chemical compound characterized by its unique structure, which includes a benzimidazole core with a chlorine substituent at the 5-position. This compound typically appears as a white to off-white solid and is soluble in various organic solvents. It exhibits properties that are common to benzimidazole derivatives, such as potential biological activity, making it of interest in pharmaceutical research. The presence of the chlorine atom can influence its reactivity and interaction with biological targets. Additionally, the compound may exhibit properties such as antimicrobial or antifungal activity, which are often explored in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 5-chloro-1,3-dihydro-2H-benzimidazol-2-one is a compound with significant potential in various chemical and biological applications.
Formula:C7H5ClN2O
InChI:InChI=1/C7H5ClN2O/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H2,9,10,11)
InChI key:QIGIQLYKEULMQQ-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Cl)[nH]c(n2)O
Synonyms:
  • 2H-benzimidazol-2-one, 5-chloro-1,3-dihydro-
  • 5-Chloro-1H-benzoimidazol-2-ol
  • 5-Chloro-1,3-dihydro-2H-benzimidazol-2-one
Found 7 products.