CAS 2034-69-7
:Daphnoretin
Description:
Daphnoretin is a natural compound classified as a flavonoid, specifically a type of phenolic compound. It is primarily derived from various plant sources, particularly those belonging to the Daphne genus. The chemical structure of Daphnoretin features a chromone backbone, which is characteristic of many flavonoids, and it exhibits a range of biological activities. Daphnoretin has been studied for its potential antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve the modulation of various signaling pathways and the scavenging of free radicals. Additionally, Daphnoretin's solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in both research and potential therapeutic contexts. As with many natural compounds, further studies are needed to fully elucidate its pharmacokinetics, bioavailability, and safety profile in humans.
Formula:C19H12O7
InChI:InChI=1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3
InChI key:InChIKey=JRHMMVBOTXEHGJ-UHFFFAOYSA-N
SMILES:O(C1=CC=2C(OC1=O)=CC(O)=C(OC)C2)C=3C=C4C(=CC3)C=CC(=O)O4
Synonyms:- 2H-1-benzopyran-2-one, 7-hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-
- 7-Hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-2H-1-benzopyran-2-one
- Coumarin, 7-hydroxy-6-methoxy-3,7′-oxydi-
- Daphnoretin
- NSC 291852
- Thymelol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2H-1-Benzopyran-2-one, 7-hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-
CAS:Formula:C19H12O7Purity:98%Color and Shape:SolidMolecular weight:352.2944Daphnoretin
CAS:LactoneFormula:C19H12O7Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:352.3Daphnoretin
CAS:Daphnoretin is a naturally occurring lignan, which is a type of product derived from plant sources, particularly species of the genus Daphne. It is characterized by its complex chemical structure and is known for its potential bioactive properties. The mode of action of daphnoretin involves modulating various cellular pathways, including those related to apoptosis and oxidative stress, through its interaction with cellular receptors and enzymes. This modulation can lead to either the inhibition or activation of specific cellular processes, which is of significant interest in scientific research.Formula:C19H12O7Purity:Min. 95%Color and Shape:PowderMolecular weight:352.29 g/mol







