CAS 20340-53-8
:1'-methyl-3-phenyl-3,4'-bipiperidine-2,6-dione
Description:
1'-Methyl-3-phenyl-3,4'-bipiperidine-2,6-dione, identified by its CAS number 20340-53-8, is a chemical compound characterized by its unique bipiperidine structure, which consists of two piperidine rings connected by a carbonyl group. This compound features a methyl group at the 1' position and a phenyl group at the 3 position, contributing to its distinct chemical properties. The presence of the diketone functional groups (2,6-dione) indicates that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic phenyl group, which may influence its solubility in organic solvents. Additionally, the structural features suggest potential biological activity, making it of interest in medicinal chemistry. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through empirical studies. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in pharmaceuticals.
Formula:C17H22N2O2
InChI:InChI=1/C17H22N2O2/c1-19-11-8-14(9-12-19)17(13-5-3-2-4-6-13)10-7-15(20)18-16(17)21/h2-6,14H,7-12H2,1H3,(H,18,20,21)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
