CAS 2034154-09-9

Imidazo[1,2-a]pyrazine, 3-chloro-5,6,7,8-tetrahydro-, hydrochloride (1:2)

Description:

Imidazo[1,2-a]pyrazine, 3-chloro-5,6,7,8-tetrahydro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyrazine moieties. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing rings. The presence of the chloro substituent at the 3-position may influence its reactivity and interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities would depend on further empirical studies. Its CAS number, 2034154-09-9, allows for precise identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, this compound represents a class of substances that may have significant implications in drug development and research.

Formula: C₆H₈ClN₃·2ClH

InChI: InChI=1S/C6H8ClN3.2ClH/c7-5-3-9-6-4-8-1-2-10(5)6;;/h3,8H,1-2,4H2;2*1H

InChI key: InChIKey=AWFKNKRZRLLHPH-UHFFFAOYSA-N

SMILES: ClC=1N2C(CNCC2)=NC1.Cl

Synonyms:

• Imidazo[1,2-a]pyrazine, 3-chloro-5,6,7,8-tetrahydro-, hydrochloride (1:2)

3-chloro-5H,6H,7H,8H-imidazo[1,2-a]pyrazine

CAS: 2034154-09-9

Formula: C₆H₁₀Cl₃N₃

Purity: 95.0%

Molecular weight: 230.52

Ref: 10-F515390

3-Chloro-5H,6H,7H,8H-imidazo[1,2-a]pyrazine dihydrochloride

CAS: 2034154-09-9

Versatile small molecule scaffold

Formula: C₆H₁₀Cl₃N₃

Purity: Min. 95%

Molecular weight: 230.5 g/mol

Ref: 3D-JGD15409