CymitQuimica logo

CAS 203450-07-1

:

2-(5-hydroxy-2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione

Description:
The chemical substance known as 2-(5-hydroxy-2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione, with the CAS number 203450-07-1, is a complex organic compound characterized by its unique structural features. It contains an isoindole moiety fused with a piperidine ring that is substituted with a hydroxyl group and two carbonyl groups, contributing to its potential reactivity and biological activity. The presence of these functional groups suggests that the compound may exhibit properties such as hydrogen bonding and potential interactions with biological macromolecules. Its molecular structure indicates it may be involved in various chemical reactions, possibly serving as a precursor or intermediate in synthetic pathways. Additionally, compounds of this nature are often studied for their pharmacological properties, which may include anti-inflammatory, antimicrobial, or anticancer activities. However, specific biological activities and applications would require further investigation through experimental studies. Overall, this compound represents a fascinating area of study within medicinal chemistry and organic synthesis.
Formula:C13H10N2O5
InChI:InChI=1/C13H10N2O5/c16-9-5-8(10(17)14-11(9)18)15-12(19)6-3-1-2-4-7(6)13(15)20/h1-4,8-9,16H,5H2,(H,14,17,18)
SMILES:c1ccc2c(c1)C(=O)N(C1CC(C(=O)N=C1O)O)C2=O
Synonyms:
  • 1H-isoindole-1,3(2H)-dione, 2-(5-hydroxy-2,6-dioxo-3-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.