CAS 20347-71-1
:2-(3,4-Dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl]oxy]-3,4-dihydro-2H-1-benzopyran-3,4,5,7-tetrol
Description:
The chemical substance known as "2-(3,4-Dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl]oxy]-3,4-dihydro-2H-1-benzopyran-3,4,5,7-tetrol," with the CAS number 20347-71-1, is a complex polyphenolic compound. It features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of multiple benzopyran structures indicates that it may exhibit biological activity, particularly in relation to its interaction with various biological systems. This compound is likely to be soluble in organic solvents and may have limited solubility in water due to its large molecular structure. Its intricate arrangement of functional groups suggests potential applications in pharmaceuticals, particularly in the development of natural products or dietary supplements aimed at promoting health benefits. Additionally, the compound's structural characteristics may influence its stability, reactivity, and interaction with other molecules, making it a subject of interest in both medicinal chemistry and biochemistry research.
Formula:C30H26O13
InChI:InChI=1S/C30H26O13/c31-14-7-19(35)16-11-25(28(41-23(16)9-14)12-1-3-17(33)20(36)5-12)43-30(13-2-4-18(34)21(37)6-13)29(40)27(39)26-22(38)8-15(32)10-24(26)42-30/h1-10,25,27-29,31-40H,11H2
InChI key:InChIKey=HGVVOUNEGQIPMS-UHFFFAOYSA-N
SMILES:O(C1(OC=2C(C(O)C1O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)C4C(OC=5C(C4)=C(O)C=C(O)C5)C6=CC(O)=C(O)C=C6
Synonyms:- 2H-1-Benzopyran-3,4,5,7-tetrol, 2-(3,4-dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl]oxy]-3,4-dihydro-
- 3,3′,4,4′,5,7-Flavanhexol, 2-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-chromanyl]oxy]-
- 2-(3,4-Dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl]oxy]-3,4-dihydrochromene-3,4,5,7-tetrol
- Procyanidin
- 2-(3,4-Dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl]oxy]-3,4-dihydro-2H-1-benzopyran-3,4,5,7-tetrol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2H-1-Benzopyran-3,4,5,7-tetrol, 2-(3,4-dihydroxyphenyl)-2-[[2-(3,4-dihydroxyphenyl)-3,4-dihydro-5,7-dihydroxy-2H-1-benzopyran-3-yl]oxy]-3,4-dihydro-
CAS:Formula:C30H26O13Purity:95%Color and Shape:SolidMolecular weight:594.5196Proanthocyanidins
CAS:Proanthocyanidins is a natural product, used as antioxidant and anti-cancers agent.Formula:C30H26O13Purity:99.63%Color and Shape:SolidMolecular weight:594.52Proanthocyanidins
CAS:Proanthocyanidins are polyphenolic compounds, which are naturally occurring antioxidants found in various plant sources such as grapes, apples, berries, and pine bark. These compounds are involved in the plant's own defense mechanisms against stressors and contribute to their coloration and taste. The mode of action of proanthocyanidins is primarily through their antioxidant properties, which enable them to scavenge free radicals and reduce oxidative stress in biological systems. This action helps in modulating inflammatory pathways and supports vascular health by enhancing blood circulation.
Formula:C30H26O13Purity:Min. 95%Color and Shape:PowderMolecular weight:594.52 g/mol



