CAS 2035-50-9: 6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene

Description:6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene is a polycyclic compound characterized by its complex fused ring structure, which includes both benzofuran and chromene moieties. This compound typically exhibits a range of interesting chemical properties, including potential biological activity, which has drawn attention in medicinal chemistry. Its structure suggests it may participate in various chemical reactions, such as electrophilic substitutions or cycloadditions, due to the presence of electron-rich aromatic systems. The compound's stereochemistry, particularly the dihydro configuration, can influence its reactivity and interactions with biological targets. Additionally, it may exhibit fluorescence properties, making it useful in certain analytical applications. The presence of multiple functional groups in its structure can also lead to diverse solubility characteristics in different solvents. Overall, 6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its potential applications and effects.

Formula:C₁₅H₁₂O₂

InChI:InChI=1/C15H12O2/c1-4-8-14-10(5-1)12-9-16-13-7-3-2-6-11(13)15(12)17-14/h1-8,12,15H,9H2