CAS 203506-01-8

6-bromo-3-methylquinolin-2-amine

Description:

6-Bromo-3-methylquinolin-2-amine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a methyl group at the 3-position of the quinoline ring contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its aromatic nature. It may participate in various chemical reactions, such as electrophilic substitutions due to the electron-rich nature of the quinoline ring. Additionally, the amino group at the 2-position can act as a nucleophile, making it reactive in coupling reactions or as a ligand in coordination chemistry. The compound's structure suggests potential biological activity, which may be explored in medicinal chemistry for its pharmacological properties. As with many brominated compounds, it may also exhibit specific environmental and safety considerations, necessitating careful handling and disposal in laboratory settings.

Formula: C₁₀H₉BrN₂

InChI: InChI=1/C10H9BrN2/c1-6-4-7-5-8(11)2-3-9(7)13-10(6)12/h2-5H,1H3,(H2,12,13)

SMILES: Cc1cc2cc(ccc2[nH]c1=N)Br

Synonyms:

• 2-Quinolinamine, 6-Bromo-3-Methyl-
• 6-Bromo-3-methylquinolin-2-amine

2-Quinolinamine, 6-bromo-3-methyl-

CAS: 203506-01-8

Formula: C₁₀H₉BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 237.0959

Ref: IN-DA0028X6

2-Amino-6-bromo-3-methylquinoline

CAS: 203506-01-8

2-Amino-6-bromo-3-methylquinoline

Formula: C₁₀H₉BrN₂

Purity: 95%

Color and Shape: yellow powder

Molecular weight: 237.09586g/mol

Ref: 54-OR3650

6-Bromo-3-methyl-quinolin-2-amine

CAS: 203506-01-8

Purity: 98%

Molecular weight: 237.1000061

Ref: 10-F719260