CAS 20351-54-6
:2-(naphthalen-2-yl)propan-2-ol
Description:
2-(Naphthalen-2-yl)propan-2-ol, also known by its CAS number 20351-54-6, is an organic compound characterized by its structure, which features a naphthalene ring substituted with a propan-2-ol group. This compound is a tertiary alcohol, meaning it has three carbon atoms bonded to the carbon bearing the hydroxyl (-OH) group. It typically appears as a colorless to pale yellow liquid and is known for its aromatic properties due to the presence of the naphthalene moiety. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water, reflecting the hydrophobic nature of the naphthalene ring. Its chemical properties may include reactivity typical of alcohols, such as oxidation and esterification. Additionally, it may serve as an intermediate in organic synthesis or as a potential building block in the development of pharmaceuticals or other chemical products. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H14O
InChI:InChI=1/C13H14O/c1-13(2,14)12-8-7-10-5-3-4-6-11(10)9-12/h3-9,14H,1-2H3
SMILES:CC(C)(c1ccc2ccccc2c1)O
Synonyms:- 2-(2-Naphthyl)-2-propanol
- alpha,alpha-Dimethyl-2-naphthalenemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Naphthalen-2-yl)propan-2-ol
CAS:2-(Naphthalen-2-yl)propan-2-olPurity:97%Molecular weight:186.25g/molRef: 10-F398184
50mg86.00€100mg133.00€250mg223.00€500mg378.00€1g530.00€2.5g1,079.00€5g2,012.00€10g3,452.00€2-(2-Naphthyl)-2-propanol
CAS:2-(2-Naphthyl)-2-propanol is a reactive chemical that is orally administered, and interacts with tissues to produce extents. The molecule has been shown to be magnetic resonance spectroscopic (MRS) detectable. 2-(2-Naphthyl)-2-propanol reacts with chloride ions and produces 2-chloro-1-naphthol and 2-(2-naphthyl)ethanol, which can be used as biomarkers for its presence in the body. This chemical also reacts with isopropyl groups to form epoxides or peroxides, depending on the extent of reaction. Irradiation of this compound by UV light yields hydroxypyridinium salts. 2-(2-Naphthyl)-2-propanol may interact with metal ions such as iron, copper, or zinc.Formula:C13H14OPurity:Min. 95%Molecular weight:186.25 g/mol



