CAS 203521-95-3

N-Cbz-4-Methylisonipecotic acid ethyl ester

Description:

N-Cbz-4-Methylisonipecotic acid ethyl ester is a chemical compound characterized by its structure, which includes a carbobenzyloxy (Cbz) protecting group, a methyl group at the 4-position, and an isonipecotic acid backbone. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules. Its ethyl ester form enhances its solubility and reactivity, making it suitable for various chemical reactions, including esterification and amidation. The presence of the Cbz group allows for selective deprotection under mild conditions, facilitating further functionalization of the molecule. Additionally, the compound may exhibit biological activity due to its structural similarity to neurotransmitter precursors, which can be of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential hazards and ensuring proper safety protocols are followed. Overall, N-Cbz-4-Methylisonipecotic acid ethyl ester serves as a valuable intermediate in synthetic organic chemistry.

Formula: C₁₇H₂₃NO₄

InChI: InChI=1/C17H23NO4/c1-3-21-15(19)17(2)9-11-18(12-10-17)16(20)22-13-14-7-5-4-6-8-14/h4-8H,3,9-13H2,1-2H3

InChI key: SYAKUJRVWRTGOB-UHFFFAOYSA-N

SMILES: CCOC(=O)C1(C)CCN(CC1)C(=O)OCc1ccccc1

Synonyms:

• 4-Methyl-1,4-piperidinedicarboxylic acid 4-ethyl 1-(phenylmethyl) ester
• N-Cbz-4-Methyl Isonipecotic Acid Ethyl Ester
• 1-Benzyl 4-Ethyl 4-Methylpiperidine-1,4-Dicarboxylate

N-Cbz-4-methylisonipecotic acid ethyl ester

CAS: 203521-95-3

Formula: C₁₇H₂₃NO₄

Molecular weight: 305.3688

Ref: IN-DA0028YN