CAS 20353-70-2
:3-(piperidin-1-yl)propyl 8,9-dimethoxy-2-methyl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate
Description:
3-(Piperidin-1-yl)propyl 8,9-dimethoxy-2-methyl-5,6-dihydropyrrolo[2,1-a]isoquinoline-3-carboxylate, with CAS number 20353-70-2, is a chemical compound characterized by its complex structure, which includes a piperidine moiety and a pyrroloisoquinoline framework. This compound features multiple functional groups, including methoxy and carboxylate groups, contributing to its potential biological activity. The presence of the piperidine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its dihydropyrroloisoquinoline core may exhibit unique pharmacological properties, potentially influencing neurochemical pathways. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the presence of substituents. Such characteristics are crucial for understanding its behavior in biological systems and its potential applications in drug development. Overall, this compound represents a class of organic molecules that may have significant implications in pharmacology and therapeutic research.
Formula:C24H32N2O4
InChI:InChI=1/C24H32N2O4/c1-17-14-20-19-16-22(29-3)21(28-2)15-18(19)8-12-26(20)23(17)24(27)30-13-7-11-25-9-5-4-6-10-25/h14-16H,4-13H2,1-3H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyrrolo[2,1-a]isoquinoline-3-carboxylic acid, 5,6-dihydro-8,9-dimethoxy-2-methyl-, 3-(1-piperidinyl)propyl ester
CAS:Formula:C24H32N2O4Molecular weight:412.5219
