CAS 20357-21-5

2-Bromo-6-nitrobenzaldehyde

Description:

2-Bromo-6-nitrobenzaldehyde is an organic compound characterized by its aromatic structure, featuring a bromine atom and a nitro group attached to a benzaldehyde moiety. The presence of the bromine atom at the second position and the nitro group at the sixth position of the benzene ring contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a yellow to orange solid and is known for its moderate solubility in organic solvents such as ethanol and dichloromethane. It is often utilized in the synthesis of various pharmaceuticals and agrochemicals due to its electrophilic properties, which facilitate further chemical transformations. Additionally, the nitro group can serve as a versatile functional group for subsequent reactions, including reduction and substitution processes. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential environmental hazards. Proper storage and disposal methods are essential to mitigate these risks.

Formula: C₇H₄BrNO₃

InChI: InChI=1S/C7H4BrNO3/c8-6-2-1-3-7(9(11)12)5(6)4-10/h1-4H

InChI key: InChIKey=WRIAMYXQKSDDRP-UHFFFAOYSA-N

SMILES: C(=O)C1=C(N(=O)=O)C=CC=C1Br

Synonyms:

• Benzaldehyde, 2-Bromo-6-Nitro-
• Wnr Ce Bvh
• 2-Bromo-6-nitrobenzaldehyde

Benzaldehyde, 2-bromo-6-nitro-

CAS: 20357-21-5

Formula: C₇H₄BrNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 230.0156

Ref: IN-DA0028ZQ

2-Bromo-6-nitrobenzaldehyde

CAS: 20357-21-5

2-Bromo-6-nitrobenzaldehyde

Formula: C₇H₄BrNO₃

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 230.02g/mol

Ref: 54-OR914307

2-Bromo-6-nitrobenzaldehyde

CAS: 20357-21-5

Formula: C₇H₄BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 230.017

Ref: 10-F214852