CAS 20357-70-4

2-methoxydibenzofuran

Description:

2-Methoxydibenzofuran is an organic compound characterized by its unique structure, which consists of a dibenzofuran core with a methoxy group (-OCH₃) attached at the second position. This compound typically exhibits a white to light yellow crystalline appearance. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the methoxy group can influence its solubility and reactivity, making it a subject of interest in medicinal chemistry. Additionally, 2-methoxydibenzofuran may exhibit biological activity, although specific pharmacological properties would require further investigation. Its molecular formula and weight contribute to its physical and chemical properties, such as melting point, boiling point, and stability under various conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₁₃H₁₀O₂

InChI: InChI=1/C13H10O2/c1-14-9-6-7-13-11(8-9)10-4-2-3-5-12(10)15-13/h2-8H,1H3

SMILES: COc1ccc2c(c1)c1ccccc1o2

Synonyms:

• 2-Methoxydibenzo[B,D]Furan

2-Methoxydibenzo[b,d]furan

CAS: 20357-70-4

Formula: C₁₃H₁₀O₂

Molecular weight: 198.2173

Ref: IN-DA0028ZI

4-Methoxy-8-oxatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),3,5,10,12-hexaene

CAS: 20357-70-4

Versatile small molecule scaffold

Formula: C₁₃H₁₀O₂

Purity: Min. 95%

Molecular weight: 198.22 g/mol

Ref: 3D-VAA35770