CAS 20358-01-4
:7-Chloro-2-benzothiazolamine
Description:
7-Chloro-2-benzothiazolamine, with the CAS number 20358-01-4, is an organic compound characterized by the presence of a benzothiazole ring, which is a bicyclic structure consisting of a benzene ring fused to a thiazole ring. This compound features a chlorine atom at the 7-position of the benzothiazole moiety and an amino group at the 2-position, contributing to its reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the amino group allows for hydrogen bonding, which can influence its interaction with other chemical species. 7-Chloro-2-benzothiazolamine is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. However, handling this compound requires caution, as it may pose health risks, and appropriate safety measures should be observed. Its specific applications and reactivity can vary based on the context of use and the presence of other functional groups in a given formulation.
Formula:C7H5ClN2S
InChI:InChI=1/C7H5ClN2S/c8-4-2-1-3-5-6(4)11-7(9)10-5/h1-3H,(H2,9,10)
InChI key:InChIKey=QLMIQSNEKFGKFN-UHFFFAOYSA-N
SMILES:ClC1=C2C(N=C(N)S2)=CC=C1
Synonyms:- 2-Amino-7-chlorobenzothiazole
- 2-Benzothiazolamine, 7-Chloro-
- 7-Chloro-2-benzothiazolamine
- Benzothiazole, 2-amino-7-chloro-
- 7-Chlorobenzo[d]thiazol-2-aMine
- 7-Chloro-1,3-benzothiazol-2-amine
- 7-Chlorobenzo[d]thiazole-2-amine, 97%
- 7-Chloro-benzothiazol-2-ylamine
- 7-Chlorobenzothiazol-2-amine
- 2-Amino-7-chlorobenzothiazol
- 2-Benzothiazolamine,7-chloro-(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Benzothiazolamine, 7-chloro-
CAS:Formula:C7H5ClN2SPurity:97%Color and Shape:SolidMolecular weight:184.64607-Chlorobenzo[d]thiazol-2-amine
CAS:7-Chlorobenzo[d]thiazol-2-aminePurity:97%Molecular weight:184.65g/mol7-Chlorobenzo[d]thiazol-2-amine
CAS:Formula:C7H5ClN2SPurity:97%Color and Shape:SolidMolecular weight:184.647-Chlorobenzo[d]thiazol-2-amine
CAS:7-Chlorobenzo[d]thiazol-2-amine is a synthetic intermediate used in the production of dyes, pigments, and pharmaceuticals. It is prepared by the reaction of 2-aminobenzothiazole with nitrous acid and 7-chloroacetophenone. 7-Chlorobenzo[d]thiazol-2-amine can be cleaved at the 2 position to produce 2,4,5-trichlorobenzothiazole. The infrared absorption spectrum of 7-chlorobenzo[d]thiazol-2-amine has been recorded in the solid phase at room temperature and shows three bands between 1710 cm−1 and 1700 cm−1.Formula:C7H5ClN2SPurity:Min. 95%Molecular weight:184.65 g/mol



