CAS 20358-05-8
:7-Bromo-2-benzothiazolamine
Description:
7-Bromo-2-benzothiazolamine is an organic compound characterized by its unique structure, which includes a benzothiazole ring and an amine functional group. The presence of the bromine atom at the 7-position of the benzothiazole contributes to its reactivity and potential applications in various chemical reactions. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science, due to its biological activity and ability to act as a building block for more complex molecules. It may exhibit properties such as antimicrobial or antifungal activity, making it of interest for pharmaceutical applications. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Safety data should be reviewed, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 7-Bromo-2-benzothiazolamine is a versatile compound with significant potential in various scientific fields.
Formula:C7H5BrN2S
InChI:InChI=1S/C7H5BrN2S/c8-4-2-1-3-5-6(4)11-7(9)10-5/h1-3H,(H2,9,10)
InChI key:InChIKey=YHKASBDRJLTLHH-UHFFFAOYSA-N
SMILES:BrC1=C2C(N=C(N)S2)=CC=C1
Synonyms:- 2-Amino-7-bromobenzothiazole
- 7-Bromo-2-benzothiazolamine
- 7-Bromobenzo[d]thiazol-2-amine
- Benzothiazole, 2-amino-7-bromo-
- 2-Benzothiazolamine, 7-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Benzothiazolamine, 7-bromo-
CAS:Formula:C7H5BrN2SPurity:96%Color and Shape:SolidMolecular weight:229.09702-Amino-7-bromo-1,3-benzothiazole
CAS:2-Amino-7-bromo-1,3-benzothiazoleFormula:C7H5BrN2SPurity:≥95%Color and Shape: off-white to pale yellow solidMolecular weight:229.10g/mol7-Bromobenzo[d]thiazol-2-amine
CAS:Formula:C7H5BrN2SPurity:96%Color and Shape:SolidMolecular weight:229.17-Bromo-1,3-benzothiazol-2-amine
CAS:7-Bromo-1,3-benzothiazol-2-amine is a heterocyclic compound with the chemical formula CHBrN. It is synthesized by reacting 2-aminobenzothiazole with aniline in the presence of acid. The product has been shown to have traceless reactions and can be used for solid phase synthesis. 7-Bromo-1,3-benzothiazol-2-amine has been shown to undergo cleavage under acidic conditions, which is useful for the synthesis of other heterocyclic compounds.
Formula:C7H5BrN2SPurity:Min. 95%Molecular weight:229.1 g/mol



