CAS 20364-30-1

1,2,3,4-Tetrahydro-2,2-dimethylquinoline

Description:

1,2,3,4-Tetrahydro-2,2-dimethylquinoline is a bicyclic organic compound belonging to the class of quinolines, which are characterized by a fused benzene and pyridine ring structure. This specific compound features a saturated tetrahydroquinoline framework with two methyl groups attached to the second carbon of the ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its molecular structure imparts certain chemical reactivity, making it a subject of interest in medicinal chemistry. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 1,2,3,4-Tetrahydro-2,2-dimethylquinoline represents a versatile compound in the field of organic chemistry.

Formula: C₁₁H₁₅N

InChI: InChI=1S/C11H15N/c1-11(2)8-7-9-5-3-4-6-10(9)12-11/h3-6,12H,7-8H2,1-2H3

InChI key: InChIKey=YJVRDLFDNAGZBT-UHFFFAOYSA-N

SMILES: CC1(C)NC=2C(CC1)=CC=CC2

Synonyms:

• 1,2,3,4-Tetrahydro-2,2-dimethylquinoline
• 2,2-Dimethyl-1,2,3,4-tetrahydro-quinoline
• 2,2-Dimethyl-1,2,3,4-tetrahydroquinoline
• Quinoline, 1,2,3,4-tetrahydro-2,2-dimethyl-

4-METHYLPYRIDINE-N-OXIDE

CAS: 20364-30-1

Formula: C₁₁H₁₅N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 161.2435

Ref: IN-DA00BGO8

2,2-Dimethyl-1,2,3,4-tetrahydroquinoline

CAS: 20364-30-1

Purity: ≥95%

Molecular weight: 161.2480011

Ref: 10-F639797

2,2-Dimethyl-1,2,3,4-tetrahydroquinoline

CAS: 20364-30-1

2,2-Dimethyl-1,2,3,4-tetrahydroquinoline is a molecule with the chemical formula C8H10N. It is a white crystalline solid that has a pyridine ring and a tetrahydroquinoline ring. 2,2-Dimethyl-1,2,3,4-tetrahydroquinoline has been shown to interact with nitrogen atoms in its environment. This process can lead to the formation of an N-oxide or carbonyl groups at the nitrogen atom. The molecule has also been shown to react with methyl groups and form stoichiometric amounts of n-oxides or carbonyl groups. 2,2-Dimethyl-1,2,3,4-tetrahydroquinoline can be used as a desorption agent for gas chromatography (GC).

Formula: C₁₁H₁₅N

Purity: Min. 95%

Molecular weight: 161.24 g/mol

Ref: 3D-VAA36430