CAS 203645-53-8
:2,2-dichlorovinyl bis(trideuteriomethyl) phosphate
Description:
2,2-Dichlorovinyl bis(trideuteriomethyl) phosphate is an organophosphate compound characterized by its unique molecular structure, which includes a dichlorovinyl group and two trideuteriomethyl groups attached to a phosphate moiety. This compound is notable for its potential use in various applications, including as an insecticide or herbicide, due to the presence of the phosphate functional group, which is commonly associated with biological activity. The presence of deuterium in the trideuteriomethyl groups can influence the compound's physical and chemical properties, such as its stability and reactivity, as well as its isotopic labeling for research purposes. The dichlorovinyl group contributes to the compound's lipophilicity, which can affect its bioavailability and environmental persistence. As with many organophosphates, safety considerations are paramount, as they can exhibit toxicity to non-target organisms, including humans. Therefore, handling and usage guidelines must be strictly followed to mitigate any potential risks associated with this chemical substance.
Formula:C4HD6Cl2O4P
InChI:InChI=1/C4H7Cl2O4P/c1-8-11(7,9-2)10-3-4(5)6/h3H,1-2H3/i1D3,2D3
SMILES:C(OP(=O)(OC([2H])([2H])[2H])OC=C(Cl)Cl)([2H])([2H])[2H]
Synonyms:- 2,2-Dichlorovinyl bis[(2
- Phosphoric Acid, 2,2-Dichloroethenyl Dimethyl-D3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dichlorvos-d6 (dimethyl-d6)
CAS:Purity:99 atom % DColor and Shape:Colorless-Pale Yellow LiquidMolecular weight:227.01Dichlorvos D6 (dimethyl D6) 100 µg/mL in Cyclohexane
CAS:Controlled ProductFormula:C4H6HCl2O4PColor and Shape:Single SolutionMolecular weight:227.01Dichlorvos D6 (dimethyl D6)
CAS:Controlled ProductFormula:C4H6HCl2O4PColor and Shape:NeatMolecular weight:227.01Dichlorvos-d6
CAS:Controlled ProductApplications Dichlorvos-d6 is a deuterated analogue of Dichlorvos a Cholinesterase inhibitor. Anthelmintic, insecticide. Used as a standard for Pesticide detection. Also used in Cannabis testing.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Gaines, T.B., et al.: Toxicol. Appl. Pharmacol., 14, 515 (1969), Reuber, M.D., et al.: Clin. Toxicol., 18, 47 (1981),Formula:C42H6HCl2O4PColor and Shape:Clear Colourless To BrownMolecular weight:227.01Phosphoric acid, 2,2-dichloroethenyl di(methyl-d3) ester
CAS:Formula:C4HCl2D6O4PColor and Shape:LiquidMolecular weight:227.0127




