CAS 203645-59-4
:(3-methyl-4-nitro-phenoxy)-thioxo-bis(trideuteriomethoxy)-$l^{5}-phosphane
Description:
(3-Methyl-4-nitro-phenoxy)-thioxo-bis(trideuteriomethoxy)-$l^{5}-phosphane, with CAS number 203645-59-4, is a chemical compound that features a complex structure incorporating a phosphane moiety. This compound is characterized by the presence of a phenoxy group substituted with a methyl and a nitro group, which can influence its reactivity and solubility. The thioxo group indicates the presence of a sulfur atom double-bonded to the phosphorus, contributing to its unique chemical properties. The incorporation of trideuteriomethoxy groups suggests that the compound has been isotopically labeled, which can be useful in studies involving reaction mechanisms or tracking the compound in various environments. Overall, the combination of these functional groups suggests potential applications in organic synthesis, catalysis, or as a ligand in coordination chemistry. The specific characteristics, such as stability, reactivity, and solubility, would depend on the overall molecular structure and the interactions between the various functional groups present in the compound.
Formula:C9H6D6NO5PS
InChI:InChI=1/C9H12NO5PS/c1-7-6-8(4-5-9(7)10(11)12)15-16(17,13-2)14-3/h4-6H,1-3H3/i2D3,3D3
SMILES:Cc1cc(ccc1N(=O)=O)OP(=S)(OC([2H])([2H])[2H])OC([2H])([2H])[2H]
Synonyms:- O,O-Bis[(2
- phosphorothioic acid, O,O-dimethyl-d3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Fenitrothion-d6(O,O-dimethyl-d6)
CAS:Purity:99 atom % DColor and Shape:Yellow OilMolecular weight:283.27Fenitrothion D6 (O,O-dimethyl D6) 100 µg/mL in Cyclohexane
CAS:Controlled ProductFormula:C9H6H6NO5PSColor and Shape:Single SolutionMolecular weight:283.27Fenitrothion D6 (O,O-dimethyl D6)
CAS:Controlled ProductFormula:C9H6H6NO5PSColor and Shape:NeatMolecular weight:283.27Fenitrothion-d6 (O,O-dimethyl-d6)
CAS:<p>Fenitrothion-d6 (O,O-dimethyl-d6) is a deuterated compound of Fenitrothion. Fenitrothion has a CAS number of 122-14-5. Fenitrothion is an organothiophosphate cholinesterase inhibitor. Fenitrothion is used as an insecticide.</p>Formula:C9H6D6NO5PSColor and Shape:SolidMolecular weight:283.27Fenitrothion-d6
CAS:Controlled Product<p>Applications Insecticide.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Nishizawa, Y., et al.: Agric. Biol. Chem., 25, 605 (1961),<br></p>Formula:C92H6H6NO5PSColor and Shape:Clear Colourless To YellowMolecular weight:283.27Phosphorothioic acid, O,O-di(methyl-d3) O-(3-methyl-4-nitrophenyl) ester (9CI)
CAS:Formula:C9H6D6NO5PSColor and Shape:LiquidMolecular weight:283.2710





