CAS 20367-33-3
:N-(2-Nitro-4-propoxyphenyl)acetamide
Description:
N-(2-Nitro-4-propoxyphenyl)acetamide, with the CAS number 20367-33-3, is an organic compound characterized by its acetamide functional group attached to a phenyl ring that is further substituted with a nitro group and a propoxy group. This compound typically exhibits properties associated with both aromatic and amide functionalities, such as moderate solubility in organic solvents and potential reactivity due to the presence of the nitro group, which can participate in electrophilic substitution reactions. The propoxy group enhances the lipophilicity of the molecule, potentially influencing its biological activity and interaction with other substances. Additionally, the nitro group may impart specific electronic properties, making the compound of interest in various chemical and pharmaceutical applications. Its structural features suggest potential uses in medicinal chemistry, particularly in the development of compounds with specific biological activities. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with nitro-containing compounds.
Formula:C11H14N2O4
InChI:InChI=1S/C11H14N2O4/c1-3-6-17-9-4-5-10(12-8(2)14)11(7-9)13(15)16/h4-5,7H,3,6H2,1-2H3,(H,12,14)
InChI key:InChIKey=SCCDPJHRMIEZGA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NC(C)=O)C=CC(OCCC)=C1
Synonyms:- Acetamide, N-(2-nitro-4-propoxyphenyl)-
- Acetanilide, 2′-nitro-4′-propoxy-
- N-(2-Nitro-4-propoxyphenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
