CAS 20368-24-5
:Leucylleucyltyrosine
Description:
Leucylleucyltyrosine, with the CAS number 20368-24-5, is a synthetic peptide composed of the amino acids leucine and tyrosine. This compound is characterized by its specific sequence, which influences its biological activity and properties. Peptides like leucylleucyltyrosine often exhibit unique solubility profiles, stability, and reactivity due to their amino acid composition and sequence. The presence of leucine, a hydrophobic amino acid, contributes to the peptide's structural stability and potential interactions with lipid membranes, while tyrosine, which contains a phenolic hydroxyl group, can participate in hydrogen bonding and may influence the peptide's reactivity and interaction with other biomolecules. Leucylleucyltyrosine may be of interest in various fields, including biochemistry and pharmacology, for its potential roles in signaling pathways or as a model for studying peptide interactions. However, specific applications and biological functions would depend on further research and context regarding its use in scientific studies or therapeutic developments.
Formula:C21H33N3O5
InChI:InChI=1S/C21H33N3O5/c1-12(2)9-16(22)19(26)23-17(10-13(3)4)20(27)24-18(21(28)29)11-14-5-7-15(25)8-6-14/h5-8,12-13,16-18,25H,9-11,22H2,1-4H3,(H,23,26)(H,24,27)(H,28,29)/t16-,17-,18-/m0/s1
InChI key:InChIKey=UCNNZELZXFXXJQ-BZSNNMDCSA-N
SMILES:[C@H](C(N[C@@H](CC1=CC=C(O)C=C1)C(O)=O)=O)(NC([C@H](CC(C)C)N)=O)CC(C)C
Synonyms:- 10: PN: WO2013116663 SEQID: 6 unclaimed protein
- 2: PN: WO2009046832 PAGE: 100 claimed protein
- <span class="text-smallcaps">L</smallcap>-Leucyl-<smallcap>L</smallcap>-leucyl-<smallcap>L</span>-tyrosine
- <span class="text-smallcaps">L</smallcap>-Tyrosine, <smallcap>L</smallcap>-leucyl-<smallcap>L</span>-leucyl-
- <span class="text-smallcaps">L</smallcap>-Tyrosine, N-(N-<smallcap>L</smallcap>-leucyl-<smallcap>L</span>-leucyl)-
- H-Leu-Leu-Tyr-OH
- L-leucyl-L-leucyl-L-tyrosine
- Leucylleucyltyrosine
- Tyrosine, N-(N-<span class="text-smallcaps">L</smallcap>-leucyl-<smallcap>L</smallcap>-leucyl)-, <smallcap>L</span>-
- L-Tyrosine, N-(N-L-leucyl-L-leucyl)-
- L-Tyrosine, L-leucyl-L-leucyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Leucyl-leucyl-tyrosine
CAS:Leucyl-leucyl-tyrosine is a bioactive chemical.Formula:C21H33N3O5Color and Shape:SolidMolecular weight:407.5H-Leu-Leu-Tyr-OH
CAS:Controlled ProductApplications H-Leu-Leu-Tyr-OH (CAS# 20368-24-5) is a useful research chemical compound.
Formula:C21H33N3O5Color and Shape:NeatMolecular weight:407.504H-Leu-Leu-Tyr-OH
CAS:H-Leu-Leu-Tyr-OH is a water soluble polymer that is produced by the enzymatic polymerization of L-leucine and L-tyrosine. This polymer is cytotoxic and has been shown to bind to DNA in the cell nucleus, as well as inhibit protein synthesis. H-Leu-Leu-Tyr-OH was developed as an alternative to polyethylene glycol (PEG) due to its low toxicity, high biocompatibility, and ability to be easily synthesized.Formula:C21H33N3O5Purity:Min. 95%Molecular weight:407.5 g/mol


