CAS 2037-58-3
:10H-Phenothiazine-10-propanamine, 2-chloro-N-methyl-, 5-oxide
Description:
10H-Phenothiazine-10-propanamine, 2-chloro-N-methyl-, 5-oxide, with the CAS number 2037-58-3, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound typically exhibits properties associated with phenothiazines, such as potential pharmacological activity, including antipsychotic and antihistaminic effects. The presence of the 2-chloro and N-methyl substituents can influence its biological activity and solubility. As an oxidized derivative, the 5-oxide group may also affect its reactivity and stability. In terms of physical properties, phenothiazines generally have moderate to low solubility in water but can be more soluble in organic solvents. The compound's structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions are essential, as many phenothiazine derivatives can have significant biological effects and potential toxicity.
Formula:C16H17ClN2OS
InChI:InChI=1S/C16H17ClN2OS/c1-18-9-4-10-19-13-5-2-3-6-15(13)21(20)16-8-7-12(17)11-14(16)19/h2-3,5-8,11,18H,4,9-10H2,1H3
InChI key:InChIKey=XLXKFIZSUWGEEC-UHFFFAOYSA-N
SMILES:C(CCNC)N1C=2C(S(=O)C=3C1=CC=CC3)=CC=C(Cl)C2
Synonyms:- 10H-Phenothiazine-10-propanamine, 2-chloro-N-methyl-, 5-oxide
- Monodemethylchlorpromazine sulfoxide
- Demethylchlorpromazine sulfoxide
- Phenothiazine, 2-chloro-10-[3-(methylamino)propyl]-, 5-oxide
- Desmethylchlorpromazine sulphoxide
- Nor-chlorpromazine Sulfoxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Demethylchlorpromazine Sulfoxide
CAS:Controlled ProductFormula:C16H17ClN2OSColor and Shape:NeatMolecular weight:320.837

