CAS 2037-81-2
:Ethyl 5-phenoxycarbonylamino-1,2,3-thiadiazole-4-carboxylate
Description:
Ethyl 5-phenoxycarbonylamino-1,2,3-thiadiazole-4-carboxylate is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an ethyl ester group, and a phenoxycarbonylamino substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of nitrogen and sulfur atoms in the thiadiazole ring. The ethyl ester group contributes to its solubility in organic solvents, while the phenoxy group may enhance its interaction with biological targets. The compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the design of pharmaceuticals targeting specific biological pathways. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly in the context of drug discovery and development.
Formula:C12H11N3O4S
InChI:InChI=1/C12H11N3O4S/c1-2-9(16)19-10-11(20-15-14-10)13-12(17)18-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,13,17)
SMILES:CCC(=O)Oc1c(N=C(O)Oc2ccccc2)snn1
Synonyms:- 5-Amino-1,2,3-Thiadiazole-N-Phenoxycarbonyl-4-Carboxylic Acid Ethyl Ester
- [5-(Phenoxycarbonylamino)Thiadiazol-4-Yl] Propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 5-phenoxycarbonylamino-1,2,3-thiadiazole-4-carboxylate, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H11N3O4SPurity:98+%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:293.30Ethyl 5-((phenoxycarbonyl)amino)-1,2,3-thiadiazole-4-carboxylate
CAS:Formula:C12H11N3O4SMolecular weight:293.2984

