CAS 20370-80-3

3-(2-methoxyphenoxy)propanoic acid

Description:

3-(2-Methoxyphenoxy)propanoic acid, with the CAS number 20370-80-3, is an organic compound characterized by its structure, which includes a propanoic acid moiety linked to a 2-methoxyphenoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The methoxy group contributes to its hydrophobic characteristics, while the phenoxy group can enhance its reactivity and interaction with biological systems. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis often involves the reaction of appropriate phenolic and carboxylic acid derivatives, and it may undergo typical reactions of carboxylic acids, such as esterification or amidation. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₂O₄

InChI: InChI=1/C10H12O4/c1-13-8-4-2-3-5-9(8)14-7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)

SMILES: COc1ccccc1OCCC(=O)O

Synonyms:

• Propanoic acid, 3-(2-methoxyphenoxy)-
• 3-(2-Methoxyphenoxy)propanoic acid

3-(2-Methoxy-phenoxy)-propionic acid

CAS: 20370-80-3

Formula: C₁₀H₁₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.1999

Ref: IN-DA00BFM4

3-(2-Methoxyphenoxy)propanoic acid

CAS: 20370-80-3

3-(2-Methoxyphenoxy)propanoic acid

Purity: 97%

Molecular weight: 196.20g/mol

Ref: 54-OR962573

3-(2-Methoxyphenoxy)propanoic acid

CAS: 20370-80-3

Formula: C₁₀H₁₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.202

Ref: 10-F439707

3-(2-Methoxyphenoxy)propanoic acid

CAS: 20370-80-3

3-(2-Methoxyphenoxy)propanoic acid is a nonracemic compound that is an enantiomer of phenoxyacetic acid. 3-(2-Methoxyphenoxy)propanoic acid has been shown to inhibit the growth of bacteria by inhibiting protein synthesis. It also inhibits the production of proteins essential for cell division and causes bacterial cells to undergo apoptosis, which leads to cell death. 3-(2-Methoxyphenoxy)propanoic acid is active against both Gram-positive and Gram-negative bacteria, but is not active against Mycobacterium tuberculosis or Mycobacterium avium complex.

Formula: C₁₀H₁₂O₄

Purity: Min. 95%

Molecular weight: 196.2 g/mol

Ref: 3D-VAA37080