CAS 20372-66-1

Methyl 2,4,5-Trifluorobenzoate

Description:

Methyl 2,4,5-trifluorobenzoate is an aromatic ester characterized by the presence of a benzoate group substituted with three fluorine atoms at the 2, 4, and 5 positions of the benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a relatively low boiling point and is soluble in organic solvents, making it useful in various chemical applications. The trifluoromethyl groups contribute to its unique chemical properties, including increased lipophilicity and potential reactivity in electrophilic aromatic substitution reactions. Methyl 2,4,5-trifluorobenzoate is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fluorinated compounds due to its ability to introduce fluorine into organic molecules, which can enhance biological activity and stability. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health and environmental risks. Proper storage and handling protocols are essential to mitigate any potential hazards associated with this substance.

Formula: C₈H₅F₃O₂

InChI: InChI=1/C8H5F3O2/c1-13-8(12)4-2-6(10)7(11)3-5(4)9/h2-3H,1H3

SMILES: COC(=O)c1cc(c(cc1F)F)F

Synonyms:

• Benzoic Acid, 2,4,5-Trifluoro-, Methyl Ester
• Methyl-2,4,5-trifluorbenzolcarboxylat

Methyl 2,4,5-trifluorobenzoate

CAS: 20372-66-1

Formula: C₈H₅F₃O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 190.1193

Ref: IN-DA007QH1

Methyl 2,4,5-trifluorobenzoate

CAS: 20372-66-1

Methyl 2,4,5-trifluorobenzoate

Formula: C₈H₅F₃O₂

Purity: 99%

Color and Shape: colourless to white fused solid

Molecular weight: 190.12g/mol

Ref: 54-PC300696

Methyl 2,4,5-trifluorobenzoate

CAS: 20372-66-1

Formula: C₈H₅F₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 190.121

Ref: 10-F340090