CAS 20374-46-3
:(2E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate
Description:
(2E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate, with the CAS number 20374-46-3, is an organic compound characterized by its unique structural features. It contains a cyano group (-C≡N) and an ester functional group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the 4-chlorophenyl group indicates that it has a substituted aromatic ring, which can influence its electronic properties and interactions with other molecules. This compound typically exhibits a conjugated system due to the double bond in the prop-2-enoate moiety, which can enhance its stability and reactivity in various chemical reactions, such as nucleophilic additions or polymerization processes. Additionally, the compound may display specific physical properties, such as solubility in organic solvents and distinct melting or boiling points, depending on its molecular interactions. Its unique structure makes it of interest in fields such as medicinal chemistry and materials science, where it may serve as a precursor or intermediate in the synthesis of more complex molecules.
Formula:C10H5ClNO2
InChI:InChI=1/C10H6ClNO2/c11-9-3-1-7(2-4-9)5-8(6-12)10(13)14/h1-5H,(H,13,14)/p-1/b8-5+
Synonyms:- (2E)-3-(4-Chlorophenyl)-2-cyanoacrylic acid
- 2-Propenoic acid, 3- (4-chlorophenyl)-2-cyano-
- 2-propenoic acid, 3-(4-chlorophenyl)-2-cyano-, (2E)-
- 3-(4-Chloro-phenyl)-2-cyano-acrylic acid
- Cinnamic acid, p-chloro-.alpha.-cyano-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Propenoic acid, 3-(4-chlorophenyl)-2-cyano-, (2E)-
CAS:Formula:C10H6ClNO2Purity:98%Molecular weight:207.61314-chloro-α-Cyanocinnamic Acid
CAS:4-Chloro-α-cyanocinnamic acid (Cl-CCA), a phenylpropanoid derivative of cinnamic acid synthesized from phenylalanine by plants, exhibits a propensity for co-crystallization with a range of biomolecules, including peptides and nucleic acids.Formula:C10H6ClNO2Color and Shape:SolidMolecular weight:207.613(E)-3-(4-Chlorophenyl)-2-cyanoacrylic acid
CAS:(E)-3-(4-Chlorophenyl)-2-cyanoacrylic acidFormula:C10H6ClNO2Purity:≥95%Color and Shape:SolidMolecular weight:207.61g/mol4-Chloro-α-cyanocinnamic Acid
CAS:Controlled ProductFormula:C10H6ClNO2Color and Shape:NeatMolecular weight:207.613



