CAS 20375-42-2

(2E)-3-[3-(acetyloxy)phenyl]prop-2-enoic acid

Description:

(2E)-3-[3-(acetyloxy)phenyl]prop-2-enoic acid, also known as a derivative of cinnamic acid, is characterized by its structure, which features a prop-2-enoic acid backbone with an acetyloxy group attached to a phenyl ring. This compound typically exhibits properties associated with both phenolic and carboxylic acid functionalities, including potential antioxidant and anti-inflammatory activities. The presence of the acetyloxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. It is likely to be a solid at room temperature, with a specific melting point that can vary based on purity and crystallization conditions. The compound may also display UV-Vis absorbance characteristics due to the conjugated double bond system, making it useful in various applications, including pharmaceuticals and organic synthesis. Its CAS number, 20375-42-2, allows for easy identification in chemical databases and literature. Overall, this compound is of interest in both synthetic chemistry and medicinal applications due to its unique structural features and potential bioactivity.

Formula: C₁₁H₁₀O₄

InChI: InChI=1/C11H10O4/c1-8(12)15-10-4-2-3-9(7-10)5-6-11(13)14/h2-7H,1H3,(H,13,14)/b6-5+

Synonyms:

• (2E)-3-(3-Acetoxyphenyl)acrylic acid
• 2-propenoic acid, 3-[3-(acetyloxy)phenyl]-, (2E)-

2-Propenoic acid, 3-[3-(acetyloxy)phenyl]-

CAS: 20375-42-2

Formula: C₁₁H₁₀O₄

Molecular weight: 206.1947

Ref: IN-DA00293T

3-Acetylcoumaric acid

CAS: 20375-42-2

3-Acetylcoumaric acid is a fine chemical that can be used as a building block to synthesize other chemicals. It is also a reagent and speciality chemical. 3-Acetylcoumaric acid is used in the synthesis of complex compounds and as an intermediate for the synthesis of other chemicals. CAS No.: 20375-42-2

Formula: C₁₁H₁₀O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 158.2 g/mol

Ref: 3D-FA69795