CAS 20377-01-9
:5-azidoquinoline
Description:
5-Azidoquinoline is a chemical compound characterized by the presence of an azido group (-N3) attached to the quinoline structure, which is a bicyclic aromatic compound consisting of a benzene ring fused to a pyridine ring. This compound is notable for its potential applications in organic synthesis and medicinal chemistry, particularly due to the reactivity of the azido group, which can participate in various chemical transformations, including click chemistry. 5-Azidoquinoline typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions, although it may be sensitive to heat and light. The presence of the azido group can impart unique electronic and steric properties, influencing its reactivity and interactions with biological targets. As with many azido compounds, safety precautions are essential when handling 5-azidoquinoline due to the potential for explosive decomposition under certain conditions. Overall, this compound serves as an interesting building block in the development of novel materials and pharmaceuticals.
Formula:C9H6N4
InChI:InChI=1/C9H6N4/c10-13-12-9-5-1-4-8-7(9)3-2-6-11-8/h1-6H
SMILES:c1cc2c(cccn2)c(c1)N=[N+]=[NH-]
Synonyms:- Quinoline, 5-azido-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Azidoquinoline
CAS:<p>5-Azidoquinoline is a molecule with the molecular formula CHN. It is classified as an oxadiazoloquinine and has a range of chemical properties that make it suitable for use in medicine, including its ability to form halides and nitro groups. 5-Azidoquinoline can also be used to synthesize other molecules, such as chloroacetone, by nucleophilic substitution reactions. The electronegativity of the 5-azido group makes it an excellent nucleophile, which allows for kinetic reactions. This molecule has six different heterocycles and can be substituted with halogens or other azides.</p>Formula:C9H6N4Purity:Min. 95%Molecular weight:170.17 g/mol
