CAS 2038-15-5
:2,3-dimethyl-1,3-benzothiazol-3-ium; methyl hydrogen sulfate
Description:
2,3-Dimethyl-1,3-benzothiazol-3-ium methyl hydrogen sulfate, with the CAS number 2038-15-5, is an organic compound that features a benzothiazole structure, which is characterized by a fused benzene and thiazole ring. This compound is typically a quaternary ammonium salt, where the benzothiazolium moiety is positively charged, and it is paired with the methyl hydrogen sulfate anion. It is known for its applications in various fields, including as a reagent in organic synthesis and as a potential dye or pigment due to its chromophoric properties. The presence of methyl groups on the benzothiazole ring can influence its solubility and reactivity, making it more lipophilic. Additionally, the methyl hydrogen sulfate component contributes to its acidity and potential use in acid-catalyzed reactions. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory or industrial settings.
Formula:C10H14NO4S2
InChI:InChI=1/C9H10NS.CH4O4S/c1-7-10(2)8-5-3-4-6-9(8)11-7;1-5-6(2,3)4/h3-6H,1-2H3;1H3,(H,2,3,4)/q+1;
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3-Dimethylbenzo[d]thiazol-3-ium methyl sulfate
CAS:Formula:C10H13NO4S2Purity:95%Color and Shape:SolidMolecular weight:275.34452,3-Dimethylbenzothiazolium Methyl Sulfate
CAS:Controlled ProductApplications 2,3-Dimethylbenzothiazolium Methyl Sulfate (cas# 2038-15-5) is a compound useful in organic synthesis.
Formula:C9H10NS·CH3O4SColor and Shape:NeatMolecular weight:275.34

