CAS 2038-32-6

6-(methylsulfanyl)pyrimidin-4-amine

Description:

6-(Methylsulfanyl)pyrimidin-4-amine, with the CAS number 2038-32-6, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a methylsulfanyl group at the 6-position contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The amino group at the 4-position enhances its ability to participate in hydrogen bonding, making it a candidate for various biological activities. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may be utilized in research related to nucleic acid interactions or as a building block in the synthesis of more complex molecules. Overall, 6-(methylsulfanyl)pyrimidin-4-amine is a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₅H₇N₃S

InChI: InChI=1/C5H7N3S/c1-9-5-2-4(6)7-3-8-5/h2-3H,1H3,(H2,6,7,8)

SMILES: CSc1cc(N)ncn1

4-PYRIMIDINAMINE, 6-(METHYLTHIO)-

CAS: 2038-32-6

Formula: C₅H₇N₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 141.1942

Ref: IN-DA00294M

6-(Methylsulfanyl)pyrimidin-4-amine

CAS: 2038-32-6

6-(Methylsulfanyl)pyrimidin-4-amine

Purity: 97%

Molecular weight: 141.19g/mol

Ref: 54-OR1042441

6-(Methylsulfanyl)pyrimidin-4-amine

CAS: 2038-32-6

Purity: 97%

Molecular weight: 141.1900024

Ref: 10-F660829

6-(Methylsulfanyl)pyrimidin-4-amine

CAS: 2038-32-6

Versatile small molecule scaffold

Formula: C₅H₇N₃S

Purity: Min. 95%

Molecular weight: 141.2 g/mol

Ref: 3D-CAA03832