CAS 20382-69-8
:(6aR)-10,11-dihydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolinium chloride
Description:
(6aR)-10,11-dihydroxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolinium chloride, with CAS number 20382-69-8, is a chemical compound that belongs to the class of dibenzoquinolinium derivatives. This substance is characterized by its complex polycyclic structure, which includes multiple fused aromatic rings, contributing to its unique chemical properties. The presence of hydroxyl groups at the 10 and 11 positions indicates that it has potential for hydrogen bonding and may exhibit solubility in polar solvents. The chloride ion associated with the compound suggests that it may form salts, influencing its stability and reactivity. This compound may have applications in pharmacology or biochemistry, particularly in studies related to neurotransmitter systems or as a potential therapeutic agent. Its stereochemistry, indicated by the (6aR) designation, implies specific spatial arrangements that can affect its biological activity and interactions with other molecules. Overall, this compound's structural features and functional groups play a crucial role in determining its chemical behavior and potential applications.
Formula:C16H16ClNO2
InChI:InChI=1/C16H15NO2.ClH/c18-13-5-4-10-8-12-14-9(6-7-17-12)2-1-3-11(14)15(10)16(13)19;/h1-5,12,17-19H,6-8H2;1H/t12-;/m1./s1
SMILES:c1cc2CCN[C@@H]3Cc4ccc(c(c4c(c1)c23)O)O.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
R-(-)-Norapomorphine Hydrochloride
CAS:Controlled ProductApplications An Apomorphine derivative as inhibitor of amyloid-β (Aβ) fibril formation and their use in amyloidosis based disease.
References Howlett, D., et al.: Biochem. J., 340, 283 (1999), Kuner, P., et al.: J. Biol. Chem., 275, 1673 (2000), Ono, K., et al.: J. Neurosci. Res., 75, 742 (2004),Formula:C16H15NO2•HClPurity:>90%Color and Shape:NeatMolecular weight:253.303646R-(-)-Norapomorphine Hydrochloride (1.0mg/ml in Methanol)
CAS:Controlled ProductFormula:C16H15NO2•HClColor and Shape:Single SolutionMolecular weight:253.303646
