CAS 20383-85-1

1-[2-(2-chlorophenoxy)ethyl]piperazine

Description:

1-[2-(2-chlorophenoxy)ethyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 2-(2-chlorophenoxy)ethyl substituent, indicating the presence of a chlorinated phenyl group linked through an ether bond to an ethyl chain. The chlorophenoxy group contributes to the compound's lipophilicity and potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in organic solvents. The presence of the piperazine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperazine derivatives are known for their diverse biological activities, including antipsychotic and antidepressant effects. The compound's structure allows for interactions with various biological targets, making it of interest in drug design and development. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₇ClN₂O

InChI: InChI=1/C12H17ClN2O/c13-11-3-1-2-4-12(11)16-10-9-15-7-5-14-6-8-15/h1-4,14H,5-10H2

SMILES: c1ccc(c(c1)Cl)OCCN1CCNCC1

Synonyms:

• Piperazine, 1-[2-(2-chlorophenoxy)ethyl]-
• 1-[2-(2-Chlorophenoxy)ethyl]piperazine

1-(2-(2-Chlorophenoxy)ethyl)piperazine

CAS: 20383-85-1

Formula: C₁₂H₁₇ClN₂O

Molecular weight: 240.7292

Ref: IN-DA002959

1-[2-(2-Chlorophenoxy)ethyl]piperazine

CAS: 20383-85-1

Versatile small molecule scaffold

Formula: C₁₂H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 240.73 g/mol

Ref: 3D-VAA38385